3-Cyclopentylpropionic acid #CAS140-77-2
CAS Number：140-77-2
Chemical Formula:C8H14O2
Synonyms:
AKOS BBS-00003802
3-CYCLOPENTYLPROPIONIC ACID
Propionic acid, 3-cyclopentyl-
Appearance:Clear Colorless To Yellow Liquid
MOQ (Minimum Order Quantity): 1 FCL (Full Container Load)
3-Cyclopentylpropionic acid #CAS140-77-2
3-Cyclopentylpropionic acid is an organic compound with the chemical formula C8H14O2. It belongs to the aliphatic organic acid group and is often used as a prodrug by combining with the hydroxyl groups of some drugs to form corresponding esters.
Application of 3-Cyclopentylpropionic acid
3-Cyclopentylpropionic acid can be used as an organic building blocks in the synthesis of variety of pharmaceutical compound. It is used for the synthesis of Testosterone Cypionate (T155100).
| 3-Cyclopentylpropionic acid Basic information |
| Product Name: | 3-Cyclopentylpropionic acid |
| Synonyms: | CYCLOPENTANEPROPIONIC ACID;AKOS BBS-00003802;3-CYCLOPENTYLPROPIONIC ACID;cyclopentanepropanoicacid;Cyclopentylpropionic acid;Propionic acid, 3-cyclopentyl-;3-Cyclopentane propiomicacid;3-CYCLOPENTYL PROPIONICACID 98% |
| CAS: | 140-77-2 |
| MF: | C8H14O2 |
| MW: | 142.2 |
| EINECS: | 205-433-0 |
| Product Categories: | Building Blocks;C8;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Organic acids |
| Mol File: | 140-77-2.mol |
 | |
| 3-Cyclopentylpropionic acid Chemical Properties |
| Melting point | - |
| Boiling point | 130-132 °C/12 mmHg (lit.) |
| density | 0.996 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | 116 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 4.81±0.10(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C8H14O2/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2,(H,9,10) |
| InChIKey | ZRPLANDPDWYOMZ-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)CCCC1 |
| CAS DataBase Reference | 140-77-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentanepropanoic acid(140-77-2) |
| EPA Substance Registry System | Cyclopentanepropanoic acid (140-77-2) |
| Safety Information |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
Fact Factory and Equipment Show
