Chrysin #CAS480-40-0
Chrysin, primarily found in passion fruit, honey, and propolis, is a potential therapeutic and preventative agent that inhibits the proliferation and invasion of various human cancer cells. While chrysin exhibits anticancer effects in multiple cancers, its role in ovarian cancer is poorly understood, given its poor prognosis and resistance to conventional chemotherapy. Chrysin inhibits ovarian cancer cell proliferation and induces cell death by increasing reactive oxygen species (ROS) production and cytoplasmic Ca2+ levels, as well as inducing loss of mitochondrial membrane potential (MMP). In concentration-response experiments, chrysin activated the MAPK and PI3K/AKT pathways in ES2 and OV90 cells. Chrysin inhibits tumor growth by modulating the canonical Wnt and nuclear factor NF-κB signaling pathway cascades. Compared to untreated control cells, chrysin stimulated phosphorylation of AKT and P70S6K proteins in ES2 and OV90 cells. In addition, Chrysin can also activate phosphorylated ERK1/2, p38 and JNK proteins of MAPK pathway members in ovarian cancer cells.
Chrysin is a natural flavonoid with antioxidant, anti-inflammatory, and anticancer properties. It blocks COX-2 gene expression, PGE2 production, and hydroxyl radical formation in LPS-induced RAW 264.7 cells. Chrysin inhibits insulin-induced HIF-1α expression (~50% at 10 μM) in human prostate cancer DU145 cells and blocks DU145 xenograft-induced angiogenesis in vivo. In a mouse model of ischemia/reperfusion injury, chrysin decreased pro-inflammatory gene expression and oxidative stress, resulting in a reduction of infarct volume and neurological defects.
Application of Chrysin
Chrysin is a flavanoid with anti-inflammatory effect and potential protective effects against cancer and cardiovascular disease. Studies show that Chrysin is central benzodiazepine receptor ligand with possible anxiolytic effects. Chrysin was initially believed to have aromatase inhibitor but recent in vivo studies have disproved that. Dyes and metabolites.
| Chrysin Chemical Properties |
| Melting point | 284-286 °C(lit.) |
| Boiling point | 357.45°C (rough estimate) |
| density | 1.2693 (rough estimate) |
| refractive index | 1.4872 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 6.50±0.40(Predicted) |
| color | Yellow |
| λmax | 348 nm |
| Merck | 14,2256 |
| BRN | 233276 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2C(=O)C=C(Oc2c1)c3ccccc3 |
| LogP | 3.520 |
| CAS DataBase Reference | 480-40-0(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | LK8329050 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
Fact Factory and Equipment Show


